Introduction：Basic information about CAS 121-53-9|m-Carboxybenzenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | m-Carboxybenzenesulfonic acid |
|---|
| CAS Number | 121-53-9 | Molecular Weight | 202.18500 |
|---|
| Density | 1.62g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H6O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | m-Carboxybenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.62g/cm3 |
|---|
| Molecular Formula | C7H6O5S |
|---|
| Molecular Weight | 202.18500 |
|---|
| Exact Mass | 201.99400 |
|---|
| PSA | 100.05000 |
|---|
| LogP | 1.71230 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | QMWGSOMVXSRXQX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(S(=O)(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| m-Sulfobenzoic Acid |
| m-Benzoesaeuresulfonsaeure |
| 3-sulfo-benzoic acid |
| meta-sulfobenzoic acid |
| 3-sulphobenzoic acid |
| EINECS 204-478-3 |
| 3-carboxybenzenesulfonic acid |
| 3-sulfosalicylic acid |
