Introduction：Basic information about CAS 874338-84-8|3-PYRIDAZINAMINE, 6-(2-PHENYLETHYL)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-PYRIDAZINAMINE, 6-(2-PHENYLETHYL)- |
|---|
| CAS Number | 874338-84-8 | Molecular Weight | 199.25200 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 393.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.4ºC |
|---|
Names
| Name | 6-(2-Phenylethyl)-3-pyridazinamine |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 393.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13N3 |
|---|
| Molecular Weight | 199.25200 |
|---|
| Flash Point | 220.4ºC |
|---|
| Exact Mass | 199.11100 |
|---|
| PSA | 52.53000 |
|---|
| LogP | 1.77410 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | GHBOYEBISSFRRD-UHFFFAOYSA-N |
|---|
| SMILES | C1=CC=C(C=C1)CCC2=NN=C(C=C2)N |
|---|
