Introduction：Basic information about CAS 1110-02-7|Cucurbitacin L, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cucurbitacin L |
|---|
| CAS Number | 1110-02-7 | Molecular Weight | 516.66600 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 696.7ºC at 760mmHg |
|---|
| Molecular Formula | C30H44O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 389.1ºC |
|---|
Names
| Name | (8S,9R,10R,13R,14S,16R,17R)-17-[(2R)-2,6-dihydroxy-6-methyl-3-oxoheptan-2-yl]-2,16-dihydroxy-4,4,9,13,14-pentamethyl-8,10,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthrene-3,11-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 696.7ºC at 760mmHg |
|---|
| Molecular Formula | C30H44O7 |
|---|
| Molecular Weight | 516.66600 |
|---|
| Flash Point | 389.1ºC |
|---|
| Exact Mass | 516.30900 |
|---|
| PSA | 132.13000 |
|---|
| LogP | 3.84340 |
|---|
| Vapour Pressure | 1.9E-22mmHg at 25°C |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | PIGAXYFCLPQWOD-ILFSFOJUSA-N |
|---|
| SMILES | CC(C)(O)CCC(=O)C(C)(O)C1C(O)CC2(C)C3CC=C4C(C=C(O)C(=O)C4(C)C)C3(C)C(=O)CC12C |
|---|
Synonyms
| cucurbitacins L |
| Cucurbitacin L |
| dihydrocucurbitacin I |
| 19-Nor-9beta,10alpha-lanosta-1,5-diene-3,11,22-trione,2,16alpha,20,25-tetrahydroxy-9-methyl |
| Isocucurbitacin L |
