Introduction：Basic information about CAS 123174-58-3|Perylene Red, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Perylene Red |
|---|
| CAS Number | 123174-58-3 | Molecular Weight | 1079.240 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C72H58N2O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Perylene Red |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C72H58N2O8 |
|---|
| Molecular Weight | 1079.240 |
|---|
| Exact Mass | 1078.419312 |
|---|
| PSA | 115.06000 |
|---|
| LogP | 18.70 |
|---|
| Index of Refraction | 1.707 |
|---|
| InChIKey | ZZSIDSMUTXFKNS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cc(Oc3ccccc3)c3c4c(Oc5ccccc5)cc5c6c(cc(Oc7ccccc7)c(c7c(Oc8ccccc8)cc(c2c37)C1=O)c64)C(=O)N(c1c(C(C)C)cccc1C(C)C)C5=O |
|---|
Synonyms
| Isoquino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-bis[2,6-bis(1-methylethyl)phenyl]-5,6,12,13-tetraphenoxy- |
| Anthra(2,1,9-def:6,5,10-d'E'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone,2,9-bis(2,6-bis(1-methylethyl)phenyl)-5,6,12,13-tetraphenoxy |
| UNII-1283KGS16D |
| Basf ROT 300 |
| N,N'-Bis(2,6-diisopropylphenyl)-1,6,7,12-tetraphenoxyperylene-3,4:9,10-tetracarboxdiimide |
| 2,9-Bis(2,6-diisopropylphenyl)-5,6,12,13-tetraphenoxyisoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone |
| 1,6,7,12-Tetraphenoxy-N,N'-bis(2,6-diisopropylphenyl)-3,4,9,10-penylenedicaroximide |
| KF-856 |
| Lumogen Red 300 |
| ROT-300 |
