Introduction：Basic information about CAS 150971-43-0|(S)-(-)-2,2'-Bis(di-i-propylphosphino)-6,6'-dimethoxy-1,1'-biphen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(-)-2,2'-Bis(di-i-propylphosphino)-6,6'-dimethoxy-1,1'-biphenyl,min. |
|---|
| CAS Number | 150971-43-0 | Molecular Weight | 446.54200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C26H40O2P2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | [2-[2-di(propan-2-yl)phosphanyl-6-methoxyphenyl]-3-methoxyphenyl]-di(propan-2-yl)phosphane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C26H40O2P2 |
|---|
| Molecular Weight | 446.54200 |
|---|
| Exact Mass | 446.25000 |
|---|
| PSA | 45.64000 |
|---|
| LogP | 7.21880 |
|---|
| Appearance of Characters | Powder | white |
|---|
| InChIKey | HLLUWVKDDQIKNF-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(P(C(C)C)C(C)C)c1-c1c(OC)cccc1P(C(C)C)C(C)C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 29319090 |
|---|
Synonyms
| Benzeneethanol-d5 |
| 2-<2H5>Phenylaethanol |
| |A-Phenethyl Alcohol-d5 |
| 2-Phenylethanol-d5 |
| phenylethanol-d5 |
| MFCD09753011 |
| ring-deuterated phenyl ethanol |
| 2-Phenyl-1-ethanol-d5 |
| |A-Phenylethanol-d5 |
| Phenylethyl Alcohol-d5 |
| Phenethyl Alcohol-d5 |
| |A-Phenethylol-d5 |
| |A-Phenethanol-d5 |
| 2-pentadeuteriophenyl-ethanol |
| R-i-Pr-MeO-Biphep |
| 2-Phenethanol-d5 |
