Introduction：Basic information about CAS 86696-87-9|Aganodine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Aganodine |
|---|
| CAS Number | 86696-87-9 | Molecular Weight | 245.10800 |
|---|
| Density | 1.65g/cm3 | Boiling Point | 434.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10Cl2N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.4ºC |
|---|
Names
| Name | 2-(4,7-dichloro-1,3-dihydroisoindol-2-yl)guanidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.65g/cm3 |
|---|
| Boiling Point | 434.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10Cl2N4 |
|---|
| Molecular Weight | 245.10800 |
|---|
| Flash Point | 216.4ºC |
|---|
| Exact Mass | 244.02800 |
|---|
| PSA | 65.14000 |
|---|
| LogP | 2.83590 |
|---|
| Index of Refraction | 1.727 |
|---|
| InChIKey | DFKHOVYSCCPSHR-UHFFFAOYSA-N |
|---|
| SMILES | NC(N)=NN1Cc2c(Cl)ccc(Cl)c2C1 |
|---|
Synonyms
| Aganodine [INN] |
| Aganodine |
| Aganodin |
| Aganodinum |
| UNII-670P9AQR46 |
