Introduction：Basic information about CAS 2015-19-2|5-Amino-2-chlorobenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Amino-2-chlorobenzenesulfonamide |
|---|
| CAS Number | 2015-19-2 | Molecular Weight | 206.65000 |
|---|
| Density | 1.558 | Boiling Point | 454.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H7ClN2O2S | Melting Point | 169-171ºC |
|---|
| MSDS | / | Flash Point | 228.7ºC |
|---|
Names
| Name | 5-Amino-2-chlorobenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.558 |
|---|
| Boiling Point | 454.5ºC at 760mmHg |
|---|
| Melting Point | 169-171ºC |
|---|
| Molecular Formula | C6H7ClN2O2S |
|---|
| Molecular Weight | 206.65000 |
|---|
| Flash Point | 228.7ºC |
|---|
| Exact Mass | 205.99200 |
|---|
| PSA | 94.56000 |
|---|
| LogP | 2.93190 |
|---|
| Vapour Pressure | 1.89E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | FDDSVQLOFIBCDH-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(Cl)c(S(N)(=O)=O)c1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 5-Amino-2-chlor-benzolsulfonamid |
| 3-aminosulfonyl-4-chloroaniline |
| 4-Chloroaniline-3-sulfonamide |
| 4-Chloranilin-5-sulfonamid |
| EINECS 217-943-0 |
| 4-Chlor-3-sulfamoylanilin |
| 4-chloro-3-sulfamoylaniline |
