Introduction：Basic information about CAS 20139-66-6|p-Acetoacetophenetidide, 2,2''-((2,2'-dichloro-4,4'-biphenylyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Acetoacetophenetidide, 2,2''-((2,2'-dichloro-4,4'-biphenylylene)bis(azo))bis- |
|---|
| CAS Number | 20139-66-6 | Molecular Weight | 717.59800 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 839.4ºC at 760 mmHg |
|---|
| Molecular Formula | C36H34Cl2N6O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 461.5ºC |
|---|
Names
| Name | 2-[[3-chloro-4-[2-chloro-4-[[1-(4-ethoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-N-(4-ethoxyphenyl)-3-oxobutanamide |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 839.4ºC at 760 mmHg |
|---|
| Molecular Formula | C36H34Cl2N6O6 |
|---|
| Molecular Weight | 717.59800 |
|---|
| Flash Point | 461.5ºC |
|---|
| Exact Mass | 716.19200 |
|---|
| PSA | 160.24000 |
|---|
| LogP | 8.96380 |
|---|
| Vapour Pressure | 2.15E-28mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | ANRPYVOIZUOOMQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(NC(=O)C(N=Nc2ccc(-c3ccc(N=NC(C(C)=O)C(=O)Nc4ccc(OCC)cc4)cc3Cl)c(Cl)c2)C(C)=O)cc1 |
|---|
