Introduction：Basic information about CAS 19742-92-8|Bis(3-chlorophenyl) disulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(3-chlorophenyl) disulfide |
|---|
| CAS Number | 19742-92-8 | Molecular Weight | 287.228 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 373.4±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.0±20.9 °C |
|---|
Names
| Name | 1-chloro-3-[(3-chlorophenyl)disulfanyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 373.4±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl2S2 |
|---|
| Molecular Weight | 287.228 |
|---|
| Flash Point | 168.0±20.9 °C |
|---|
| Exact Mass | 285.944458 |
|---|
| PSA | 50.60000 |
|---|
| LogP | 5.57 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.695 |
|---|
| InChIKey | OLOYVIPZMIIGOH-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cccc(SSc2cccc(Cl)c2)c1 |
|---|
Synonyms
| 3,3'-Dichloro diphenyl disulfide |
| Bis(3-chlorophenyl) disulfide |
| Disulfide, bis(3-chlorophenyl) |
| 1,1'-Disulfanediylbis(3-chlorobenzene) |
| 3,3'-Dichlorodiphenyl disulfide |
| QC-42 |
| MFCD08460161 |
