Introduction：Basic information about CAS 4273-98-7|2-Aminodiphenylsulfone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Aminodiphenylsulfone |
|---|
| CAS Number | 4273-98-7 | Molecular Weight | 233.286 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 439.6±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H11NO2S | Melting Point | 120-122 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 219.7±24.0 °C |
|---|
Names
| Name | 2-(Phenylsulfonyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 439.6±28.0 °C at 760 mmHg |
|---|
| Melting Point | 120-122 °C(lit.) |
|---|
| Molecular Formula | C12H11NO2S |
|---|
| Molecular Weight | 233.286 |
|---|
| Flash Point | 219.7±24.0 °C |
|---|
| Exact Mass | 233.051056 |
|---|
| PSA | 68.54000 |
|---|
| LogP | 2.05 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | JBCUKQQIWSWEOK-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccccc1S(=O)(=O)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xn:Harmful |
|---|
| Risk Phrases | R22;R36/37/38 |
|---|
| Safety Phrases | S36/37/39-S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(benzenesulfonyl)aniline |
| Benzenamine, 2-(phenylsulfonyl)- |
| 2-Aminophenyl Phenyl Sulfone |
| 2-Aminodiphenylsulfone |
| 2-(Phenylsulfonyl)aniline |
| MFCD00007706 |
| EINECS 224-271-1 |
| 2-Aminodiphenyl Sulfone |
