Introduction：Basic information about CAS 197662-64-9|ethyl-4-(triethoxysilyl) benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl-4-(triethoxysilyl) benzoate |
|---|
| CAS Number | 197662-64-9 | Molecular Weight | 312.43400 |
|---|
| Density | 1.06g/cm3 | Boiling Point | 334.635ºC at 760 mmHg |
|---|
| Molecular Formula | C15H24O5Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 129.813ºC |
|---|
Names
| Name | ethyl-4-(triethoxysilyl) benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.06g/cm3 |
|---|
| Boiling Point | 334.635ºC at 760 mmHg |
|---|
| Molecular Formula | C15H24O5Si |
|---|
| Molecular Weight | 312.43400 |
|---|
| Flash Point | 129.813ºC |
|---|
| Exact Mass | 312.13900 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 2.11870 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.484 |
|---|
| InChIKey | IYBIDUBBUBVKMU-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc([Si](OCC)(OCC)OCC)cc1 |
|---|
Synonyms
| 4-(tert-butyl-dimethyl-silanyloxy)-cyclohexanecarboxylic acid ethyl ester |
| ethyl 1,2,4,5-tertafluoro-3-methoxybenzene |
| Ethyl (cis/trans)-4-<(tert-butyldimethylsilyl)oxy>cyclohexanecarboxylate |
| cis/trans-ethyl{[(1,1-dimethylethyl)(dimethyl)silyl]oxy}cyclohexanecarboxylate |
| ethyl 4-(triethoxysilyl)benzoate |
| ethyl cis/trans-4-{[(1,1-dimethylethyl)(dimethyl)silyl]oxy}cyclohexanecarboxylate |
| cis/trans-ethyl 4-([(1,1-dimethylethyl)(dimethyl)silyl]oxy)cyclohexanecarboxylate |
| ethyl 4-(tert-butyldimethylsilyloxy)cyclohexanecarboxylate |
