Introduction：Basic information about CAS 83088-26-0|(E)-3,3',4,5'-TETRAMETHOXYSTILBENE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E)-3,3',4,5'-TETRAMETHOXYSTILBENE |
|---|
| CAS Number | 83088-26-0 | Molecular Weight | 300.349 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 447.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H20O4 | Melting Point | 69 °C |
|---|
| MSDS | / | Flash Point | 145.9±34.2 °C |
|---|
Names
| Name | (e)-3,3',4,5'-tetramethoxystilbene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 447.6±40.0 °C at 760 mmHg |
|---|
| Melting Point | 69 °C |
|---|
| Molecular Formula | C18H20O4 |
|---|
| Molecular Weight | 300.349 |
|---|
| Flash Point | 145.9±34.2 °C |
|---|
| Exact Mass | 300.136169 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 4.49 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | PTVAOGIYBMTHSN-AATRIKPKSA-N |
|---|
| SMILES | COc1cc(C=Cc2ccc(OC)c(OC)c2)cc(OC)c1 |
|---|
Synonyms
| 4-[(E)-2-(3,5-Dimethoxyphenyl)vinyl]-1,2-dimethoxybenzene |
| (E)-3,3',4,5'-TETRAMETHOXYSTILBENE |
| (E)-1-(3',5'-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)ethene |
| (E)-1-(3,4-dimethoxyphenyl)-2-(3,5-dimethoxyphenyl)ethene |
| trans-3,5,3',4'-tetramethoxystilbene |
| (E)-3,3',4,5'-TETRAM |
| trans-3,5,3',4'-tetramethoxypiceatannol |
| Benzene, 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1,2-dimethoxy- |
| 3,3',4,5'-Tetramethoxy-trans-stilbene |
| 3,3',4,5'-TetraMethoxypiceatannol |
| trans-3,3',4',5-tetramethoxystilbene |
| (E)-3,5,3',4'-tetramethoxystilbene |
| 4-(2-(3,5-Dimethoxyphenyl)vinyl)-1,2-dimethoxybenzene |
| (E)-3,4,3',5'-Tetramethoxystilbene |
| 4-[(E)-2-(3,5-Dimethoxyphenyl)ethenyl]-1,2-dimethoxybenzene |
