Introduction：Basic information about CAS 15805-10-4|5,5'-methylenebis(1H-benzotriazole), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,5'-methylenebis(1H-benzotriazole) |
|---|
| CAS Number | 15805-10-4 | Molecular Weight | 250.259 |
|---|
| Density | 1.502 | Boiling Point | 543.1±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10N6 | Melting Point | 238-240 ºC |
|---|
| MSDS | / | Flash Point | 261.9±25.8 °C |
|---|
Names
| Name | 5-(2H-benzotriazol-5-ylmethyl)-2H-benzotriazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.502 |
|---|
| Boiling Point | 543.1±60.0 °C at 760 mmHg |
|---|
| Melting Point | 238-240 ºC |
|---|
| Molecular Formula | C13H10N6 |
|---|
| Molecular Weight | 250.259 |
|---|
| Flash Point | 261.9±25.8 °C |
|---|
| Exact Mass | 250.096695 |
|---|
| PSA | 83.14000 |
|---|
| LogP | 2.06 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.819 |
|---|
| InChIKey | IWASLBFJTMJYHF-UHFFFAOYSA-N |
|---|
| SMILES | c1cc2n[nH]nc2cc1Cc1ccc2n[nH]nc2c1 |
|---|
Safety Information
| Hazard Codes | F |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5,5'-methylene-bis(benzotriazole) |
| 1H-1,2,3-benzotriazole, 6,6'-methylenebis- |
| 5,5'-methylenebis(1H-benzotriazole) |
| Methane,bis(5-benzotriazolyl) |
| 1H-Benzotriazole,5,5'-methylenebis |
| Bis-(1H-benzotriazol-5-yl)-methan |
| 2H-1,2,3-Benzotriazole, 5,5'-methylenebis- |
| 1H-1,2,3-benzotriazole, 5,5'-methylenebis- |
| 5,5'-Methylenebis(2H-benzotriazole) |
| 6,6'-Methylenebis(1H-benzotriazole) |
| bis-(1H-benzotriazol-5-yl)-methane |
| 5,5'-methylenebis-1H-Benzotriazole |
