Introduction：Basic information about CAS 84-67-3|m-tolidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | m-tolidine |
|---|
| CAS Number | 84-67-3 | Molecular Weight | 212.290 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 344.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H16N2 | Melting Point | 105-106ºC |
|---|
| MSDS | / | Flash Point | 192.9±26.0 °C |
|---|
Names
| Name | 2,2'-Dimethyl[1,1'-biphenyl]-4,4'-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 344.4±37.0 °C at 760 mmHg |
|---|
| Melting Point | 105-106ºC |
|---|
| Molecular Formula | C14H16N2 |
|---|
| Molecular Weight | 212.290 |
|---|
| Flash Point | 192.9±26.0 °C |
|---|
| Exact Mass | 212.131348 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 2.48 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | QYIMZXITLDTULQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N)ccc1-c1ccc(N)cc1C |
|---|
Safety Information
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| UNII-O23M27FP1T |
| 4,4'-Diamino-2,2'-dimethylbiphenyl |
| [1,1'-Biphenyl]-4,4'-diamine, 2,2'-dimethyl- |
| 2,2'-Dimethyl-4,4'-biphenyldiamine |
| (1,1'-Biphenyl)-4,4'-diamine, 2,2'-dimethyl- (9CI) |
| 2,2'-Dimethyl(1,1'-biphenyl)-4,4'-diamine |
| 2,2'-Dimethylbenzidine |
| Benzidine, 2,2'-dimethyl- |
| 4-(4-amino-2-methylphenyl)-3-methylaniline |
| m-tolidine |
| 2,2'-Dimethyl-[1,1'-biphenyl]-4,4'-diamine |
