Introduction：Basic information about CAS 216672-17-2|carboxyumbelliferyl beta-d-glucuronide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | carboxyumbelliferyl beta-d-glucuronide |
|---|
| CAS Number | 216672-17-2 | Molecular Weight | 382.27600 |
|---|
| Density | 1.837g/cm3 | Boiling Point | 758.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O11 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 281ºC |
|---|
Names
| Name | 7-[(2S,3R,4S,5S,6S)-6-carboxy-3,4,5-trihydroxyoxan-2-yl]oxy-2-oxochromene-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.837g/cm3 |
|---|
| Boiling Point | 758.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O11 |
|---|
| Molecular Weight | 382.27600 |
|---|
| Flash Point | 281ºC |
|---|
| Exact Mass | 382.05400 |
|---|
| PSA | 183.96000 |
|---|
| Vapour Pressure | 3.4E-24mmHg at 25°C |
|---|
| Index of Refraction | 1.711 |
|---|
| InChIKey | FYKJWPNWCJGLBP-DKQGBHPVSA-N |
|---|
| SMILES | O=C(O)c1cc2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)cc2oc1=O |
|---|
Synonyms
| 3-Carboxyumbelliferyl-b-D-glucuronide |
| W0182 |
