Introduction：Basic information about CAS 20290-75-9|Moroctic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Moroctic acid |
|---|
| CAS Number | 20290-75-9 | Molecular Weight | 276.414 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 412.8±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H28O2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 309.6±18.0 °C |
|---|
Names
| Name | all-cis-octadeca-6,9,12,15-tetraenoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 412.8±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H28O2 |
|---|
| Molecular Weight | 276.414 |
|---|
| Flash Point | 309.6±18.0 °C |
|---|
| Exact Mass | 276.208923 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 6.09 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.504 |
|---|
| InChIKey | JIWBIWFOSCKQMA-LTKCOYKYSA-N |
|---|
| SMILES | CCC=CCC=CCC=CCC=CCCCCC(=O)O |
|---|
Safety Information
| Hazard Codes | F: Flammable; |
|---|
| Risk Phrases | R11 |
|---|
| RIDADR | UN 1170 3/PG 2 |
|---|
Synonyms
| (4Z,8Z,12Z,15Z)-4,8,12,15-Octadecatetraenoic acid |
| Stearidonic Acid |
| 4,8,12,15-Octadecatetraenoic acid, (4Z,8Z,12Z,15Z)- |
| (4Z,8Z,12Z,15Z)-Octadeca-4,8,12,15-tetraenoic acid |
| (all-Z)-4,8,12,15-Octadecatetraenoic Acid |
| Moroctic acid |
