Introduction：Basic information about CAS 117346-08-4|2-Pathalimido-5-amino pheol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Pathalimido-5-amino pheol |
|---|
| CAS Number | 117346-08-4 | Molecular Weight | 254.241 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 518.1±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 267.1±32.9 °C |
|---|
Names
| Name | 2-(4-amino-2-hydroxyphenyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 518.1±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O3 |
|---|
| Molecular Weight | 254.241 |
|---|
| Flash Point | 267.1±32.9 °C |
|---|
| Exact Mass | 254.069138 |
|---|
| PSA | 83.63000 |
|---|
| LogP | 0.52 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.750 |
|---|
| InChIKey | WAHOJSICXGQOJH-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(N2C(=O)c3ccccc3C2=O)c(O)c1 |
|---|
Synonyms
| 2-(4-Amino-2-hydroxyphenyl)-1H-isoindole-1,3(2H)-dione |
| 2-Pathalimido-5-amino pheol |
| 5-amino-2-phthalimidophenol |
| 2-Phthalimido-5-aminophenol |
| 2-Phthalimido-5-Amino Phenol |
| 2-(4-amino-2-hydroxyphenyl)isoindoline-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione, 2-(4-amino-2-hydroxyphenyl)- |
| 1H-Isoindole-1,3(2H)-dione,2-(4-amino-2-hydroxyphenyl) |
