Introduction:Basic information about CAS 120014-30-4|5,6-Dimethoxy-2-(piperidin-4-yl)methylene-indan-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-Dimethoxy-2-(piperidin-4-yl)methylene-indan-1-one |
|---|
| CAS Number | 120014-30-4 | Molecular Weight | 289.369 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 454.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H23NO3 | Melting Point | 258-260°C (dec.) |
|---|
| MSDS | / | Flash Point | 228.4±28.7 °C |
|---|
Names
| Name | 5,6-dimethoxy-2-(piperidin-4-ylmethyl)-2,3-dihydroinden-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 454.1±45.0 °C at 760 mmHg |
|---|
| Melting Point | 258-260°C (dec.) |
|---|
| Molecular Formula | C17H23NO3 |
|---|
| Molecular Weight | 289.369 |
|---|
| Flash Point | 228.4±28.7 °C |
|---|
| Exact Mass | 289.167786 |
|---|
| PSA | 47.56000 |
|---|
| LogP | 2.88 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.538 |
|---|
| InChIKey | PGBZORAISITZTF-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1CCNCC1)C2 |
|---|
| Storage condition | Refrigerator |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5,6-Dimethoxy-2-(piperidin-4-ylmethyl)indan-1-one |
| N-Debenzyldonepezil |
| 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy-2-(4-piperidinylmethyl)- |
| 5,6-Dimethoxy-2-(4-piperidinylmethyl)-1-indanone |
| UNII-D84X9FAD1Y |
| UNII:D84X9FAD1Y |
| 2-[(4-piperidinyl)methyl]-5,6-dimethoxyindanone |
| 5,6-dimethoxy-2-(piperidin-4-ylmethyl)-2,3-dihydro-1H-inden-1-one |
| 2,3-dihydro-5,6-dimethoxy-2-(4-piperidinyl)methyl-indan-1-one |
| 5,6-dimethoxy-2-(piperidin-4-yl)methyl-indan-1-one |
| MFCD08460096 |
| 5,6-Dimethoxy-2-(piperidin-4-yl)methylene-indan-1-one |
| Donepezil Impurity 4 |