Introduction:Basic information about CAS 572923-18-3|(S)-3-(3-CHLOROPHENYL)-BETA-ALANINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-3-(3-CHLOROPHENYL)-BETA-ALANINE |
|---|
| CAS Number | 572923-18-3 | Molecular Weight | 233.26300 |
|---|
| Density | 1.162g/cm3 | Boiling Point | 373.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179.7ºC |
|---|
Names
| Name | (4S)-3-(4-acetylphenyl)-4-ethyl-1,3-oxazolidin-2-one |
|---|
Chemical & Physical Properties
| Density | 1.162g/cm3 |
|---|
| Boiling Point | 373.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15NO3 |
|---|
| Molecular Weight | 233.26300 |
|---|
| Flash Point | 179.7ºC |
|---|
| Exact Mass | 233.10500 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 2.68940 |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | XMEIBNKYPYGDRA-NSHDSACASA-N |
|---|
| SMILES | CCC1COC(=O)N1c1ccc(C(C)=O)cc1 |
|---|