Introduction：Basic information about CAS 51630-33-2|Pyrethrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pyrethrin |
|---|
| CAS Number | 51630-33-2 | Molecular Weight | 394.89100 |
|---|
| Density | 1.174g/cm3 | Boiling Point | 495.1ºC at 760mmHg |
|---|
| Molecular Formula | C24H23ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165ºC |
|---|
Names
| Name | valerate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.174g/cm3 |
|---|
| Boiling Point | 495.1ºC at 760mmHg |
|---|
| Molecular Formula | C24H23ClO3 |
|---|
| Molecular Weight | 394.89100 |
|---|
| Flash Point | 165ºC |
|---|
| Exact Mass | 394.13400 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 6.61530 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | ZVBYGQHSOONVCF-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(C(=O)OCc1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| SQ 5439 |
| 3-PHENOXYBENZYL-ISOPROPYL-4-CHLOROPHENYLACETATE |
| 3-phenoxybenzyl (2RS)-2-(4-chlorophenyl)-3-methylbutyrate |
| (3-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate |
| (3-phenoxyphenyl)methyl 4-chloro-α-(1-methylethyl)benzeneacetate |
| rac-(3-phenoxyphenyl)methyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
