Introduction：Basic information about CAS 85053-46-9|Suricainide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Suricainide |
|---|
| CAS Number | 85053-46-9 | Molecular Weight | 369.52200 |
|---|
| Density | 1.107g/cm3 | Boiling Point | 575.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H31N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 301.9ºC |
|---|
Names
| Name | 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)ethyl]-1-propan-2-ylurea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.107g/cm3 |
|---|
| Boiling Point | 575.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H31N3O3S |
|---|
| Molecular Weight | 369.52200 |
|---|
| Flash Point | 301.9ºC |
|---|
| Exact Mass | 369.20900 |
|---|
| PSA | 78.10000 |
|---|
| LogP | 3.69380 |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | OSTGVQSWUXGHKL-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCNC(=O)N(CCS(=O)(=O)c1ccccc1)C(C)C |
|---|
Synonyms
| suricainide |
| unii-28g77g373x |
| suricainide maleate |
