Introduction:Basic information about CAS 20797-48-2|(2E)-3-(4-Chloro-3-nitrophenyl)acrylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2E)-3-(4-Chloro-3-nitrophenyl)acrylic acid |
|---|
| CAS Number | 20797-48-2 | Molecular Weight | 227.601 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 408.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6ClNO4 | Melting Point | 188-190 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 200.9±25.9 °C |
|---|
Names
| Name | 4-Chloro-3-nitrocinnamic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 408.6±35.0 °C at 760 mmHg |
|---|
| Melting Point | 188-190 °C(lit.) |
|---|
| Molecular Formula | C9H6ClNO4 |
|---|
| Molecular Weight | 227.601 |
|---|
| Flash Point | 200.9±25.9 °C |
|---|
| Exact Mass | 226.998535 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.63 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | QBDALTIMHOITIU-DUXPYHPUSA-N |
|---|
| SMILES | O=C(O)C=Cc1ccc(Cl)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| trans-4-Chloro-3-nitrociamic acid |
| (2E)-3-(4-Chloro-3-nitrophenyl)acrylic acid |
| 4-Chloro-3-nitrocinnaMic Acid |
| 4-Chloro-3-nitrocinnamic Alcohol |
| 2-Propenoic acid, 3-(4-chloro-3-nitrophenyl)-, (2E)- |
| trans-3-nitro-4-chlorocinnamic acid |
| 3-Nitro-4-chlorocinnamic acid |
| Trans-4-Chloro-3-Nitrocinnamic Acid |
| 4-chloro-3-nitrophenylcinnamic acid |
| MFCD00063311 |
| 3-(4-Chloro-3-nitrophenyl)acrylic acid |
| RARECHEM BK HW 0228 |