Introduction：Basic information about CAS 26060-06-0|2-(2-THIENYL)-4H-3,1-BENZOXAZIN-4-ONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-THIENYL)-4H-3,1-BENZOXAZIN-4-ONE |
|---|
| CAS Number | 26060-06-0 | Molecular Weight | 229.25400 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 357.8ºC at 760mmHg |
|---|
| Molecular Formula | C12H7NO2S | Melting Point | 142-143ºC |
|---|
| MSDS | / | Flash Point | 170.2ºC |
|---|
Names
| Name | 2-thiophen-2-yl-3,1-benzoxazin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 357.8ºC at 760mmHg |
|---|
| Melting Point | 142-143ºC |
|---|
| Molecular Formula | C12H7NO2S |
|---|
| Molecular Weight | 229.25400 |
|---|
| Flash Point | 170.2ºC |
|---|
| Exact Mass | 229.02000 |
|---|
| PSA | 71.34000 |
|---|
| LogP | 2.91650 |
|---|
| Vapour Pressure | 2.66E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.703 |
|---|
| InChIKey | VGHJEBXWEGFRGH-UHFFFAOYSA-N |
|---|
| SMILES | O=c1oc(-c2cccs2)nc2ccccc12 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
Synonyms
| 2-(2'-thienyl)-4H-3,1-benzoxazin-4-one |
| 2-(2-thienyl)benzo[d]1,3-oxazin-4-one |
| 2-(thiophene-2-yl)-4H-3,1-benzoxazin-4-one |
| 2-(thien-2-yl)-4H-3,1-benzoxazin-4-one |
| 4-Oxo-2-(2-thienyl)-3,1-benzoxazin |
| 2-Thiophen-2-yl-benzo[d][1,3]oxazin-4-one |
| thienylbenzoxazinone |
| 2-Thiophen-2-yl-4H-3,1-benzoxazin-4-one |
