Introduction:Basic information about CAS 43188-86-9|Cortisol 3-(O-carboxymethyl)oxime, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cortisol 3-(O-carboxymethyl)oxime |
|---|
| CAS Number | 43188-86-9 | Molecular Weight | 435.51100 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 650.3±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H33NO7 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 347.1±34.3 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-[(E)-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 650.3±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H33NO7 |
|---|
| Molecular Weight | 435.51100 |
|---|
| Flash Point | 347.1±34.3 °C |
|---|
| Exact Mass | 435.22600 |
|---|
| PSA | 136.65000 |
|---|
| LogP | 2.13 |
|---|
| Vapour Pressure | 0.0±4.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | WXAWNCDYPXVODT-ZVHZXABRSA-N |
|---|
| SMILES | CC12CCC(=NOCC(=O)O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| cortisol-3-CMO |
| cortisol-3-O-carboxymethyl-oxime |
| ({(Z)-[(3Z,11β)-11,17,21-Trihydroxy-20-oxopregn-4-en-3-ylidene]amino}oxy)acetic acid |
| Acetic acid, 2-[[[(3Z,11β)-11,17,21-trihydroxy-20-oxopregn-4-en-3-ylidene]amino]oxy]- |
| Cortisol 3-(O-carboxymethyl)oxime |
| Hydrocortisone 3-(O-carboxymethyl)oxime |
| MFCD00056501 |