Introduction：Basic information about CAS 125663-37-8|tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-b, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-bromophenoxy]ethoxy]-4-methyl-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate |
|---|
| CAS Number | 125663-37-8 | Molecular Weight | 793.78100 |
|---|
| Density | 1.219g/cm3 | Boiling Point | 755.6ºC at 760mmHg |
|---|
| Molecular Formula | C39H57BrN2O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 410.8ºC |
|---|
Names
| Name | tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-bromophenoxy]ethoxy]-4-methyl-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate |
|---|
Chemical & Physical Properties
| Density | 1.219g/cm3 |
|---|
| Boiling Point | 755.6ºC at 760mmHg |
|---|
| Molecular Formula | C39H57BrN2O10 |
|---|
| Molecular Weight | 793.78100 |
|---|
| Flash Point | 410.8ºC |
|---|
| Exact Mass | 792.32000 |
|---|
| PSA | 130.14000 |
|---|
| LogP | 7.19490 |
|---|
| Vapour Pressure | 1.01E-22mmHg at 25°C |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | CLZWAWBPWVRRGI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)c(OCCOc2cc(Br)ccc2N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)c1 |
|---|
