Introduction：Basic information about CAS 15905-16-5|2,6-Pyridinedicarboxylic acid, 1-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Pyridinedicarboxylic acid, 1-oxide |
|---|
| CAS Number | 15905-16-5 | Molecular Weight | 183.11800 |
|---|
| Density | 1.6g/cm3 | Boiling Point | 644.8ºC at 760mmHg |
|---|
| Molecular Formula | C7H5NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 343.7ºC |
|---|
Names
| Name | 1-oxidopyridin-1-ium-2,6-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6g/cm3 |
|---|
| Boiling Point | 644.8ºC at 760mmHg |
|---|
| Molecular Formula | C7H5NO5 |
|---|
| Molecular Weight | 183.11800 |
|---|
| Flash Point | 343.7ºC |
|---|
| Exact Mass | 183.01700 |
|---|
| PSA | 100.06000 |
|---|
| LogP | 0.51150 |
|---|
| InChIKey | JWCYHGVYVDMHQT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(C(=O)O)[n+]1[O-] |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,6-pyridinecarboxylic acid N-oxide |
| Dipicolinic acid N-oxide |
| pyridine-2,6-dicarboxylic acid |
| 2,6-dicarboxypyridine N-oxide |
| pyridine-2,6-dicarboxylate N-oxide |
| pyridine-2,6-dicarboxylic acid-N-oxide |
| Pyridine-2,6-dicarboxylic acid 1-oxide |
| 2,6-pyridinedicarboxylic acid N-oxide |
