Introduction:Basic information about CAS 19235-88-2|2-Cyano-4-nitropyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Cyano-4-nitropyridine |
|---|
| CAS Number | 19235-88-2 | Molecular Weight | 149.107 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 302.6±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3N3O2 | Melting Point | 72°C |
|---|
| MSDS | ChineseUSA | Flash Point | 136.8±23.7 °C |
|---|
| Symbol | GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 4-nitropyridine-2-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 302.6±27.0 °C at 760 mmHg |
|---|
| Melting Point | 72°C |
|---|
| Molecular Formula | C6H3N3O2 |
|---|
| Molecular Weight | 149.107 |
|---|
| Flash Point | 136.8±23.7 °C |
|---|
| Exact Mass | 149.022522 |
|---|
| PSA | 82.50000 |
|---|
| LogP | -0.10 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | ONDDYTHSSNTDLR-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cc([N+](=O)[O-])ccn1 |
|---|
Safety Information
| Symbol | GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R23/24/25 |
|---|
| Safety Phrases | S36/37/39-S39-S26 |
|---|
| RIDADR | 3439 |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Cyano-4-nitropyridine |
| 4-Nitro-pyridine-2-carbonitrile |
| 4-Nitropicolinonitrile |
| MFCD00191627 |
| 4-Nitro-2-pyridinecarbonitrile |
| 4-nitropyridine-2-carbonitrile |
| 2-Pyridinecarbonitrile, 4-nitro- |
| 4-Nitro-2-pyridincarbonitril |
| 2-Cyan-4-nitro-pyridin |
| 2-cyano-4-nitro-pyridine |