Introduction：Basic information about CAS 20950-56-5|3,3',5-Trihydroxybiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3',5-Trihydroxybiphenyl |
|---|
| CAS Number | 20950-56-5 | Molecular Weight | 202.20600 |
|---|
| Density | 1.347g/cm3 | Boiling Point | 461ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.5ºC |
|---|
Names
| Name | 5-(3-hydroxyphenyl)benzene-1,3-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.347g/cm3 |
|---|
| Boiling Point | 461ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O3 |
|---|
| Molecular Weight | 202.20600 |
|---|
| Flash Point | 234.5ºC |
|---|
| Exact Mass | 202.06300 |
|---|
| PSA | 60.69000 |
|---|
| LogP | 2.47040 |
|---|
| Vapour Pressure | 4.05E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.676 |
|---|
| InChIKey | ZWJMMZAKZQPIHD-UHFFFAOYSA-N |
|---|
| SMILES | Oc1cccc(-c2cc(O)cc(O)c2)c1 |
|---|
Synonyms
| 3,3',5-Trihydroxy-biphenyl-monohydrat |
| (1,1'-Biphenyl)-3,3',5-triol |
| biphenyl-3,5,3'-triol |
| 3,3',5-trihydroxybiphenyl |
| 3,5,3'-Trihydroxybiphenyl |
| biphenyl-3,3',5-triol |
