Introduction:Basic information about CAS 85864-33-1|2'-BENZYL-2,2-DIMETHYLPROPIONANILIDE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'-BENZYL-2,2-DIMETHYLPROPIONANILIDE |
|---|
| CAS Number | 85864-33-1 | Molecular Weight | 267.36500 |
|---|
| Density | 1.063g/cm3 | Boiling Point | 435.7ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21NO | Melting Point | 88-90ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 266.3ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | N-(2-benzylphenyl)-2,2-dimethylpropanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.063g/cm3 |
|---|
| Boiling Point | 435.7ºC at 760 mmHg |
|---|
| Melting Point | 88-90ºC(lit.) |
|---|
| Molecular Formula | C18H21NO |
|---|
| Molecular Weight | 267.36500 |
|---|
| Flash Point | 266.3ºC |
|---|
| Exact Mass | 267.16200 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 4.33500 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | BDYMLDYIYIGVCY-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)C(=O)Nc1ccccc1Cc1ccccc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-pivaloyl-o-benzaniline |
| 2-benzyl-N-pivaloylaniline |
| o-pivaloylamododiphenylmethane |
| 2'-Benzyl-2,2-dimethylpropionanilide |
| MFCD00075427 |
| 2-Benzylpivalanilide |
| N-pivaloyl-o-benzylaniline |