Introduction：Basic information about CAS 853303-77-2|Methyl-α-butylphenylalaninat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl-α-butylphenylalaninat |
|---|
| CAS Number | 853303-77-2 | Molecular Weight | 235.322 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 325.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H21NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 175.7±19.9 °C |
|---|
Names
| Name | methyl 2-amino-2-benzylhexanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 325.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H21NO2 |
|---|
| Molecular Weight | 235.322 |
|---|
| Flash Point | 175.7±19.9 °C |
|---|
| Exact Mass | 235.157227 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 3.21 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | MTNJHLZOCXMYHU-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(N)(Cc1ccccc1)C(=O)OC |
|---|
Synonyms
| Methyl α-butylphenylalaninate |
| Phenylalanine, α-butyl-, methyl ester |
| 2-Amino-2-benzyl-hexanoic acid methyl ester |
| Phenylalanine,a-butyl-,methyl ester |
| Methyl-α-butylphenylalaninat |
