Introduction：Basic information about CAS 67654-57-3|PENTANOICACID,3-AMINO-4-METHYL-,(3R)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | PENTANOICACID,3-AMINO-4-METHYL-,(3R)- |
|---|
| CAS Number | 67654-57-3 | Molecular Weight | 221.25200 |
|---|
| Density | 1.114 g/cm3 | Boiling Point | 406.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methyl (R)-3-acetamido-3-phenylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.114 g/cm3 |
|---|
| Boiling Point | 406.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15NO3 |
|---|
| Molecular Weight | 221.25200 |
|---|
| Exact Mass | 221.10500 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 1.81780 |
|---|
| Index of Refraction | 1.513 |
|---|
| InChIKey | KAZREVDICMUGDL-LLVKDONJSA-N |
|---|
| SMILES | COC(=O)CC(NC(C)=O)c1ccccc1 |
|---|
Synonyms
| (R)-methyl-3-acetamido-3-phenylpropanoate |
| methyl (S)-3-acetylamino-3-phenylpropionate |
| (-)-S-methyl 3-amino-3-phenylpropanoate acetamide |
| 3-acetylamino-(R)-3-phenylpropionic acid methyl ester |
| methyl (S)-3-acetamido-3-phenylpropanoate |
| (S)-methyl 3-acetamido-3-phenyl-propanoate |
| methyl 3-acetylamino-3-phenylpropanoate |
