Introduction：Basic information about CAS 5422-91-3|2,5-Diphenylhydroquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Diphenylhydroquinone |
|---|
| CAS Number | 5422-91-3 | Molecular Weight | 262.30300 |
|---|
| Density | 1.209g/cm3 | Boiling Point | 486.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.1ºC |
|---|
Names
| Name | 2,5-diphenylbenzene-1,4-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.209g/cm3 |
|---|
| Boiling Point | 486.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14O2 |
|---|
| Molecular Weight | 262.30300 |
|---|
| Flash Point | 235.1ºC |
|---|
| Exact Mass | 262.09900 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 4.43180 |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | BVVCBZSERKSMIE-UHFFFAOYSA-N |
|---|
| SMILES | Oc1cc(-c2ccccc2)c(O)cc1-c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2906299090 |
|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| (1,1',4',1'')-terpheny-2,5-diol |
| 2,5-Diphenylhydroquinone |
| Hydroquinone,5-diphenyl |
| 2,5-diphenyl-1,4-dihydroquinone |
| 2,5-diphenyl-1,4-dihydroxybenzene |
| 2',5'-dihydroxy-p-terphenyl |
| p-Terphenyl-2',5'-diol |
| [1,1':4',1''-Terphenyl]-2',5'-diol |
