Introduction：Basic information about CAS 5945-42-6|aromaticin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | aromaticin |
|---|
| CAS Number | 5945-42-6 | Molecular Weight | 246.30200 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 418.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.3ºC |
|---|
Names
| Name | aromaticin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 418.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18O3 |
|---|
| Molecular Weight | 246.30200 |
|---|
| Flash Point | 187.3ºC |
|---|
| Exact Mass | 246.12600 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.27550 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | OSSDUQKWVVZIGP-UHFFFAOYSA-N |
|---|
| SMILES | C=C1C(=O)OC2CC(C)C3C=CC(=O)C3(C)CC12 |
|---|
Synonyms
| (3ar,4as,7ar,8r,9as)-4a,8-dimethyl-3-methylidene-3,3a,4,4a,7a,8,9,9a-octahydroazuleno[6,5-b]furan-2,5-dione |
| HMS2222L04 |
| Aromaticin |
| (3aS,5R,5aR,8aS,9aR)-5,8a-dimethyl-1-methylidene-3a,4,5,5a,9,9a-hexahydroazuleno[6,7-b]furan-2,8-dione |
