Introduction：Basic information about CAS 590376-88-8|5-(4-ETHYL-5-METHYLTHIEN-3-YL)-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-ETHYL-5-METHYLTHIEN-3-YL)-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL |
|---|
| CAS Number | 590376-88-8 | Molecular Weight | 239.36000 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 336.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13N3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 157.1ºC |
|---|
Names
| Name | 3-(4-ethyl-5-methylthiophen-3-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 336.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13N3S2 |
|---|
| Molecular Weight | 239.36000 |
|---|
| Flash Point | 157.1ºC |
|---|
| Exact Mass | 239.05500 |
|---|
| PSA | 97.75000 |
|---|
| LogP | 2.70310 |
|---|
| Index of Refraction | 1.695 |
|---|
| InChIKey | MKEVRZYWAPDSQO-UHFFFAOYSA-N |
|---|
| SMILES | CCc1c(-c2n[nH]c(=S)n2C)csc1C |
|---|
Synonyms
| 5-(4-ethyl-5-methylthien-3-yl)-4-methyl-4H-1,2,4-triazole-3-thiol |
| 5-(4-ethyl-5-methylthiophen-3-yl)-4-methyl-4H-1,2,4-triazole-3-thiol |
