Introduction：Basic information about CAS 438230-35-4|4-ethyl-3-(2-methylfuran-3-yl)-1H-1,2,4-triazole-5-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-ethyl-3-(2-methylfuran-3-yl)-1H-1,2,4-triazole-5-thione |
|---|
| CAS Number | 438230-35-4 | Molecular Weight | 209.26800 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 277.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11N3OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121.8ºC |
|---|
Names
| Name | 4-ethyl-3-(2-methylfuran-3-yl)-1H-1,2,4-triazole-5-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 277.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11N3OS |
|---|
| Molecular Weight | 209.26800 |
|---|
| Flash Point | 121.8ºC |
|---|
| Exact Mass | 209.06200 |
|---|
| PSA | 82.65000 |
|---|
| LogP | 2.15510 |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | RGBAHSPETWCIOA-UHFFFAOYSA-N |
|---|
| SMILES | CCn1c(-c2ccoc2C)n[nH]c1=S |
|---|
Synonyms
| HMS2438M05 |
| 4-ethyl-5-(2-methyl-3-furyl)-4H-1,2,4-triazole-3-thiol |
| 4-ethyl-5-(2-methylfuran-3-yl)-4H-1,2,4-triazole-3-thiol |
