Introduction:Basic information about CAS 85907-66-0|(Z)-11-HEXADECEN-1-YLACETATE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Z)-11-HEXADECEN-1-YLACETATE |
|---|
| CAS Number | 85907-66-0 | Molecular Weight | 209.67200 |
|---|
| Density | 1.143g/cm3 | Boiling Point | 425.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12ClNO | Melting Point | 123-125ºC |
|---|
| MSDS | / | Flash Point | 211.1ºC |
|---|
Names
| Name | 2-(4-chlorophenyl)-3-(dimethylamino)prop-2-enal |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.143g/cm3 |
|---|
| Boiling Point | 425.4ºC at 760 mmHg |
|---|
| Melting Point | 123-125ºC |
|---|
| Molecular Formula | C11H12ClNO |
|---|
| Molecular Weight | 209.67200 |
|---|
| Flash Point | 211.1ºC |
|---|
| Exact Mass | 209.06100 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 2.44140 |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | WYRALGSIFBXIIV-JXMROGBWSA-N |
|---|
| SMILES | CN(C)C=C(C=O)c1ccc(Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(p-Chlor-phenyl)-3-dimethylamino-acrolein |
| 2-(4-chlorophenyl)-3-(dimethylamino)acrolein |
| 2-(4-chlorophenyl)-3-dimethylaminoacrylaldehyde |
| 2-(p-chlorophenyl)-3-dimethylaminoprop-2-enal |
| 2-(4-chlorophenyl)-3-dimethylaminopropenal |
| (Z)-2-(4-chlorophenyl)-3-(dimethylamino)-2-propenal |
| Benzeneacetaldehyde,4-chloro-a-[(dimethylamino)methylene]-,(aZ) |
| 2-(4-Chlorophenyl)-3-(dimethylamino)-2-propenal |
| Benzeneacetaldehyde,4-chloro-a-[(dimethylamino)methylene]-,(Z)-(9CI) |