Introduction:Basic information about CAS 116574-71-1|1-Boc-3-piperidinemethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Boc-3-piperidinemethanol |
|---|
| CAS Number | 116574-71-1 | Molecular Weight | 215.289 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 308.0±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H21NO3 | Melting Point | 77-81ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 140.1±20.4 °C |
|---|
Names
| Name | N-Boc-piperidine-3-methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 308.0±15.0 °C at 760 mmHg |
|---|
| Melting Point | 77-81ºC |
|---|
| Molecular Formula | C11H21NO3 |
|---|
| Molecular Weight | 215.289 |
|---|
| Flash Point | 140.1±20.4 °C |
|---|
| Exact Mass | 215.152145 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 0.84 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.479 |
|---|
| InChIKey | OJCLHERKFHHUTB-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCCC(CO)C1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD02683203 |
| 1-Piperidinecarboxylic acid, 3-(hydroxymethyl)-, 1,1-dimethylethyl ester |
| 1-(tert-Butoxycarbonyl)-3-piperidinemethanol |
| 1-(tert-Butoxycarbonyl)-3-(hydroxymethyl)piperidine |
| 1-Boc-3-(hydroxymethyl)piperidine |
| tert-butyl 3-(hydroxymethyl)tetrahydro-1(2H)-pyridinecarboxylate |
| 2-Methyl-2-propanyl 3-(hydroxymethyl)-1-piperidinecarboxylate |
| tert-butyl 3-(Hydroxymethyl)piperidine-1-carboxylate |
| 1-Boc-3-(Hydroxymethyl) Piperidine |
| N-Boc-3-(hydroxymethyl)piperidine |
| tert-Butyl-3-(hydroxymethyl)piperidin-1-carboxylat |
| 1-Boc-3-piperidinemethanol |