Introduction：Basic information about CAS 68760-11-2|3-(Dimethylamino)-1-(4-nitrophenyl)prop-2-en-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(Dimethylamino)-1-(4-nitrophenyl)prop-2-en-1-one |
|---|
| CAS Number | 68760-11-2 | Molecular Weight | 220.22500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H12N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H12N2O3 |
|---|
| Molecular Weight | 220.22500 |
|---|
| Exact Mass | 220.08500 |
|---|
| PSA | 66.13000 |
|---|
| LogP | 2.37600 |
|---|
| InChIKey | LIOPOMJNIUNMRH-BQYQJAHWSA-N |
|---|
| SMILES | CN(C)C=CC(=O)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-(4-nitrophenyl)-3-N,N-dimethylamino-2-propen-1-one |
| 3-dimethylamino-4-nitropropiophenone |
| 3-(Dimethylamino)-1-(4-nitrophenyl)-1-propanone |
| (E)-3-(dimethylamino)-1-(4-nitrophenyl)prop-2-en-1-one |
| 3-Dimethylamino-4'-nitropropiophenon |
| 3-Dimethylamino-1-(4-nitro-phenyl)-propan-1-on |
| (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one |
| 3-dimethylamino-1-(4-nitro-phenyl)-propan-1-one |
| 3-dimethylamino-1-(4-nitrophenyl)propenone |
| 2-Propen-1-one, 3-(dimethylamino)-1-(4-nitrophenyl)-, (2E)- |
