Introduction：Basic information about CAS 355-46-4|Perfluorohexanesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Perfluorohexanesulfonic acid |
|---|
| CAS Number | 355-46-4 | Molecular Weight | 400.11500 |
|---|
| Density | 1.841g/cm3 | Boiling Point | 238.5℃ |
|---|
| Molecular Formula | C6HF13O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexane-1-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.841g/cm3 |
|---|
| Boiling Point | 238.5℃ |
|---|
| Molecular Formula | C6HF13O3S |
|---|
| Molecular Weight | 400.11500 |
|---|
| Exact Mass | 399.94400 |
|---|
| PSA | 62.75000 |
|---|
| LogP | 4.65130 |
|---|
| Index of Refraction | 1.309 |
|---|
| InChIKey | QZHDEAJFRJCDMF-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C |
|---|
| RIDADR | 3261.0 |
|---|
| Hazard Class | 8.0 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 206-587-1 |
| Tridecafluorohexanesulfonic acid |
| Perfluorohexanesulfonic acid |
| Tridecafluor-hexan-1-sulfonsaeure |
| perflourohexanesulfonic acid |
| tridecafluoro-hexane-1-sulfonic acid |
| perfluorohexane-1-sulfonic acid |
| Perfluorohexane-1-sulphonic acid |
| perfluorohexanesulfonate |
