Introduction：Basic information about CAS 126030-73-7|5,6-Difluoroindole-3-acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-Difluoroindole-3-acetic acid |
|---|
| CAS Number | 126030-73-7 | Molecular Weight | 211.165 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 423.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H7F2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 209.6±27.3 °C |
|---|
Names
| Name | 2-(5,6-Difluoro-1H-indol-3-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 423.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H7F2NO2 |
|---|
| Molecular Weight | 211.165 |
|---|
| Flash Point | 209.6±27.3 °C |
|---|
| Exact Mass | 211.044479 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 1.53 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.640 |
|---|
| InChIKey | VZWMUWNMZOYMFC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1c[nH]c2cc(F)c(F)cc12 |
|---|
Synonyms
| (5,6-Difluoro-1H-indol-3-yl)acetic acid |
| 5,6-difluoro-1h-indole-3acetic acid |
| 1H-Indole-3-acetic acid, 5,6-difluoro- |
