Introduction:Basic information about CAS 30046-31-2|1-iodo-1h,1h,2h,2h-perfluorotetradecane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-iodo-1h,1h,2h,2h-perfluorotetradecane |
|---|
| CAS Number | 30046-31-2 | Molecular Weight | 774.046 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 291.3±8.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H4F25I | Melting Point | / |
|---|
| MSDS | / | Flash Point | 138.7±5.6 °C |
|---|
Names
| Name | 1-iodo-1h,1h,2h,2h-perfluorotetradecane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 291.3±8.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H4F25I |
|---|
| Molecular Weight | 774.046 |
|---|
| Flash Point | 138.7±5.6 °C |
|---|
| Exact Mass | 773.895813 |
|---|
| LogP | 11.84 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.325 |
|---|
| InChIKey | DBXLDZXWSFMBRB-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
|---|
Synonyms
| C12F25CH2CH2I |
| C10F21CH2CH2I |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-Pentacosafluoro-14-iodotetradecane |
| 11H,11H,12H,12H,12H-heneicosafluoro-12-iodo-dodecane |
| Tetradecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-14-iodo- |
| 1H,1H,2H,2H-perfluorododecyl iodide |
| 1-iodo-1H,1H,2H,2H-perfluorodecane |
| 1-Iodo-1H,1H,2H,2H-perfluorododecane |