Introduction:Basic information about CAS 30688-66-5|4,6-O-Benzylidene-D-glucopyranose, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,6-O-Benzylidene-D-glucopyranose |
|---|
| CAS Number | 30688-66-5 | Molecular Weight | 268.263 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 521.6±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.7±23.6 °C |
|---|
Names
| Name | 4,6-o-benzylidene-d-glucopyranose |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 521.6±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16O6 |
|---|
| Molecular Weight | 268.263 |
|---|
| Flash Point | 201.7±23.6 °C |
|---|
| Exact Mass | 268.094696 |
|---|
| PSA | 88.38000 |
|---|
| LogP | 1.60 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.580 |
|---|
| InChIKey | XTVRQMKOKFFGDZ-ZLUZDFLPSA-N |
|---|
| SMILES | O=CC(O)C(O)C1OC(c2ccccc2)OCC1O |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2912499000 |
|---|
Customs
| HS Code | 2912499000 |
|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| 4,6-O-Benzylidene-D-glucose |
| 1,5-anhydro-4,6-O-benzylidene-2-deoxy-D-arabino-hex-1-enitol |
| 4,6-O-(Phenylmethylene)-D-glucose |
| 4,6-Bbstsg |
| 4,6-0-benzylidene-D-glucopyranose |
| 1,5-anhydro-4,6-O-benzylidene-3-O-tert-butyldimethylsilyl-2-deoxy-1-tributylstannyl-D-arabino-hex-1-enitol |
| 4,6-O-Benzyliden-D-gulal |
| 4,6-O-benzylidene-3-O-tert-butyldimethylsilyl-1-tri-n-butylstannyl-D-glucal |
| 4,6-O-benzylidine-D-arabino-hex-1-enitol |
| 4,6-Benzylidene-D-glucose |
| D-Glucose, 4,6-O-(phenylmethylene)- |
| 4,6-Benzyliden-1,2-didehydro-1,2-dideoxy-D-arabino-hexopyranose |
| 4,6-O-Benzylidene-3-O-tert-butyldimethylsilyl-1-tributylstannylglucal |
| 4,6-O-benzylidene dihydro-D-glucal |