Introduction:Basic information about CAS 306935-71-7|4-(3-methoxyanilino)-4-oxobut-2-enoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(3-methoxyanilino)-4-oxobut-2-enoic acid |
|---|
| CAS Number | 306935-71-7 | Molecular Weight | 221.20900 |
|---|
| Density | 1.318g/cm3 | Boiling Point | 467.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.7ºC |
|---|
Names
| Name | 4-(3-methoxyanilino)-4-oxobut-2-enoic acid |
|---|
Chemical & Physical Properties
| Density | 1.318g/cm3 |
|---|
| Boiling Point | 467.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H11NO4 |
|---|
| Molecular Weight | 221.20900 |
|---|
| Flash Point | 236.7ºC |
|---|
| Exact Mass | 221.06900 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 1.34750 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | CXOUTHKBZTXXAU-AATRIKPKSA-N |
|---|
| SMILES | COc1cccc(NC(=O)C=CC(=O)O)c1 |
|---|