Introduction：Basic information about CAS 55327-45-2|2,3,5,4'-Tetrahydroxy stilbene-2-o-D-glucoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,5,4'-Tetrahydroxy stilbene-2-o-D-glucoside |
|---|
| CAS Number | 55327-45-2 | Molecular Weight | 406.383 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 715.0±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H22O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 386.2±32.9 °C |
|---|
Names
| Name | (2S,3R,4S,5S,6R)-2-[2,4-dihydroxy-6-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 715.0±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H22O9 |
|---|
| Molecular Weight | 406.383 |
|---|
| Flash Point | 386.2±32.9 °C |
|---|
| Exact Mass | 406.126373 |
|---|
| PSA | 160.07000 |
|---|
| LogP | 0.10 |
|---|
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.761 |
|---|
| InChIKey | JAYVHSBYKLLDJC-NUABRCLCSA-N |
|---|
| SMILES | OCC1OC(Oc2c(O)cc(O)cc2C=Cc2ccc(O)cc2)C(O)C(O)C1O |
|---|
Synonyms
| β-D-Glucopyranoside, 2,4-dihydroxy-6-(2-(4-hydroxyphenyl)ethenyl)phenyl |
| (2S,3R,4S,5S,6R)-2-[2,4-dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenoxy]-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol |
| 2,3,4,5,6-PENTAFLUOROPHENYL3-NITROBENZENESULFONATE |
| 2,4-Dihydroxy-6-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl β-D-glucopyranoside |
| β-D-Glucopyranoside, 2,4-dihydroxy-6-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl |
| X1240 |
| 2,3,5,4-tetrahydroxyl |
