Introduction：Basic information about CAS 112573-72-5|Dexecadotril, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dexecadotril |
|---|
| CAS Number | 112573-72-5 | Molecular Weight | 385.47700 |
|---|
| Density | 1.206g/cm3 | Boiling Point | 574.5ºC at 760 mmHg |
|---|
| Molecular Formula | C21H23NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 301.2ºC |
|---|
Names
| Name | benzyl 2-[[(2R)-2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.206g/cm3 |
|---|
| Boiling Point | 574.5ºC at 760 mmHg |
|---|
| Molecular Formula | C21H23NO4S |
|---|
| Molecular Weight | 385.47700 |
|---|
| Flash Point | 301.2ºC |
|---|
| Exact Mass | 385.13500 |
|---|
| PSA | 101.26000 |
|---|
| LogP | 3.82490 |
|---|
| Vapour Pressure | 3.34E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | ODUOJXZPIYUATO-IBGZPJMESA-N |
|---|
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)NCC(=O)OCc1ccccc1 |
|---|
Synonyms
| Dexecadotril |
| Retorphan |
| C21H23NO4S |
