Introduction：Basic information about CAS 877171-15-8|4-Chlorobenzenesulfonic acid but-3-ynyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chlorobenzenesulfonic acid but-3-ynyl ester |
|---|
| CAS Number | 877171-15-8 | Molecular Weight | 244.69500 |
|---|
| Density | 1.338g/cm3 | Boiling Point | 357.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9ClO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 170.1ºC |
|---|
Names
| Name | but-3-ynyl 4-chlorobenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.338g/cm3 |
|---|
| Boiling Point | 357.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9ClO3S |
|---|
| Molecular Weight | 244.69500 |
|---|
| Flash Point | 170.1ºC |
|---|
| Exact Mass | 243.99600 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 3.14940 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | MXZMYISRJWSFBF-UHFFFAOYSA-N |
|---|
| SMILES | C#CCCOS(=O)(=O)c1ccc(Cl)cc1 |
|---|
Synonyms
| 4-Chlorobenzensulfonic but-3-ynyl ester |
| 4-chloro-benzenesulfonic acid but-3-ynyl ester |
| But-3-yn-1-yl 4-chlorobenzenesulfonate |
