Introduction:Basic information about CAS 868611-68-1|Ethyl 3-(2,3-difluorophenyl)-3-oxopropanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 3-(2,3-difluorophenyl)-3-oxopropanoate |
|---|
| CAS Number | 868611-68-1 | Molecular Weight | 228.19200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H10F2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Ethyl 3-(2,3-difluorophenyl)-3-oxopropanoate |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H10F2O3 |
|---|
| Molecular Weight | 228.19200 |
|---|
| Exact Mass | 228.06000 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.10070 |
|---|
| InChIKey | RPAWJNHLGNOQMI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC(=O)c1cccc(F)c1F |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|