Introduction:Basic information about CAS 155773-70-9|Nickel(II)-5,9,14,18,23,27,32,36-octabutoxy-2,3-naphthalocyanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nickel(II)-5,9,14,18,23,27,32,36-octabutoxy-2,3-naphthalocyanine |
|---|
| CAS Number | 155773-70-9 | Molecular Weight | 1348.30000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C80H88N8NiO8 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS08 | Signal Word | Danger |
|---|
Names
| Name | Ni(II) octabutoxynaphthalocyanine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C80H88N8NiO8 |
|---|
| Molecular Weight | 1348.30000 |
|---|
| Exact Mass | 1346.61000 |
|---|
| PSA | 160.89000 |
|---|
| LogP | 16.05640 |
|---|
| InChIKey | ZRFVVSDVYUSJMJ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1c2c(c(OCCCC)c3ccccc13)-c1nc-2nc2[n-]c(nc3nc(nc4[n-]c(n1)c1c(OCCCC)c5ccccc5c(OCCCC)c41)-c1c-3c(OCCCC)c3ccccc3c1OCCCC)c1c(OCCCC)c3ccccc3c(OCCCC)c21.[Ni+2] |
|---|
Safety Information
| Symbol | GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H334 |
|---|
| Precautionary Statements | P261-P284-P304 + P340-P342 + P311 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T,Xn |
|---|
| Risk Phrases | 49-43-42 |
|---|
| Safety Phrases | 53-36/37/39-45-22 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2-(methylimino-methyl)-phenol,nickel (II)-salt |
| Ni(5,9,14,18,23,27,32,36-octabutoxynaphthalocyanine(2-)) |
| 2-(Methylimino-methyl)-phenol,Nickel(II)-Salz |
| Ni(5,9,14,18,23,27,32,36-octabutoxy-2,3-naphthalocyanine) |
| bis-N-Methyl-salicylald-iminat-Ni(II) |
| MFCD00192345 |
| Ni(2-methyliminomethylphenolate)2 |
| Nickel(II)-5,9,14,18,23,27,32,36-octabutoxy-2,3-naphthalocyanine |