Introduction：Basic information about CAS 516474-08-1|1-Ethyl-2,3-dimethylimidazolium ethyl sulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Ethyl-2,3-dimethylimidazolium ethyl sulfate |
|---|
| CAS Number | 516474-08-1 | Molecular Weight | 250.31500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H18N2O4S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 149ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-ethyl-2,3-dimethylimidazol-3-ium,ethyl sulfate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H18N2O4S |
|---|
| Molecular Weight | 250.31500 |
|---|
| Flash Point | 149ºC |
|---|
| Exact Mass | 250.09900 |
|---|
| PSA | 83.62000 |
|---|
| LogP | 1.20480 |
|---|
| InChIKey | OSCREXKVIJBLHA-UHFFFAOYSA-M |
|---|
| SMILES | CCOS(=O)(=O)[O-].CCn1cc[n+](C)c1C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 1-Ethyl-2,3-dimethylimidazolium ethyl sulfate |
| MFCD06798161 |
| Basionics(R) ST 67 |
