Introduction:Basic information about CAS 156474-22-5|threo-N-Boc-D-phenylalanine epoxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | threo-N-Boc-D-phenylalanine epoxide |
|---|
| CAS Number | 156474-22-5 | Molecular Weight | 263.332 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 398.8±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.0±23.2 °C |
|---|
Names
| Name | 2-Methyl-2-propanyl {(1R)-1-[(2S)-2-oxiranyl]-2-phenylethyl}carba mate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 398.8±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21NO3 |
|---|
| Molecular Weight | 263.332 |
|---|
| Flash Point | 195.0±23.2 °C |
|---|
| Exact Mass | 263.152130 |
|---|
| PSA | 54.35000 |
|---|
| LogP | 3.44 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | NVPOUMXZERMIJK-CHWSQXEVSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C1CO1 |
|---|
Synonyms
| (2S,3R)-3-phenylproline |
| trans-3-phenyl-l-proline |
| (2S)-[1'(R)-Boc-amino-2'-phenylethyl]oxirane |
| Carbamic acid, N-[(1R)-1-[(2S)-oxiranyl]-2-phenylethyl]-, 1,1-dimethylethyl ester |
| (2S,3R)-(+)-3-Phenylpyrrolidone-2-carboxylic acid |
| (2S)-3-phenylpyrrolidine-2-carboxylic acid |
| tert-butyl [(2R,3S)]-(-)-(1-oxiranyl-2-phenylethyl)carbamate |
| trans-3-phenyl-(S)-proline |
| 3-Phenyl-D-proline |
| (2S,3R)-3-tert-butoxycarbonylamino-1,2-epoxy-4-phenylbutane |
| 2-Methyl-2-propanyl {(1R)-1-[(2S)-2-oxiranyl]-2-phenylethyl}carbamate |
| 3-Phenyl-L-Proline |
| (2S,3R)-3-phenyl-pyrrolidine-2-carboxylic acid |